24551-51-7 Usage
Description
Sodium carbonate decahydrate, also known as washing soda or soda ash, is a hydrated form of sodium carbonate (Na2CO3). It is characterized by its crystalline structure and ability to undergo thermal dehydration. The compound exhibits a similar infrared (IR) spectral profile to its heptahydrate counterpart.
Uses
Used in Chemical Analysis:
Sodium carbonate decahydrate is utilized as a reagent for investigating the hydrolysis of water-insoluble polymers, such as poly(β-cyclodextrin-co-citric acid) (CDP). High-performance liquid chromatography (HPLC) is employed to analyze the polymeric hydrolysates, providing valuable insights into the chemical properties and behavior of these materials.
Used in Industrial Processes:
In the chemical industry, sodium carbonate decahydrate serves as a precursor to the production of various sodium carbonate forms, including the monohydrate. This transformation is typically achieved through thermal dehydration in a controlled environment, such as a batch or fluidized bed reactor, which is crucial for the manufacturing of different sodium carbonate products for diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 24551-51-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,5,5 and 1 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 24551-51:
(7*2)+(6*4)+(5*5)+(4*5)+(3*1)+(2*5)+(1*1)=97
97 % 10 = 7
So 24551-51-7 is a valid CAS Registry Number.
InChI:InChI=1/CH2O3.2Na.10H2O/c2-1(3)4;;;;;;;;;;;;/h(H2,2,3,4);;;10*1H2/q;2*+1;;;;;;;;;;/p-2
