24556-15-8 Usage
General Description
Propyl 1-adamantane carboxylate is a chemical compound with the molecular formula C15H24O2. It is a derivative of adamantane, a tricyclic hydrocarbon, and is esterified with propyl alcohol. propyl 1-adaMantanecarboxylate is commonly used as a pharmaceutical intermediate and in the production of various drugs. It is also used in research and as a building block for the synthesis of other organic compounds. Additionally, propyl 1-adamantane carboxylate has shown potential biological activity, making it a subject of interest in the field of medicinal chemistry. Overall, this chemical plays a crucial role in the development and production of various pharmaceutical and research products.
Check Digit Verification of cas no
The CAS Registry Mumber 24556-15-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,5,5 and 6 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 24556-15:
(7*2)+(6*4)+(5*5)+(4*5)+(3*6)+(2*1)+(1*5)=108
108 % 10 = 8
So 24556-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H22O2/c1-2-3-16-13(15)14-7-10-4-11(8-14)6-12(5-10)9-14/h10-12H,2-9H2,1H3
