246035-38-1 Usage
Description
(S)-2-Benzothiazolyl (Z)-2-(2-aminothiazole-4-yl)-2-methoxycarbonylmethoxyiminothioacetate is a complex organic chemical compound that is a derivative of thiazole, featuring a heterocyclic structure with sulfur and nitrogen atoms. As a methoxycarbonylmethoxyiminothioester, it incorporates both ester and iminothio functional groups, along with a benzothiazolyl and an aminothiazole-4-yl group. (S)-2-Benzothiazolyl (Z)-2-(2-aminothiazole-4-yl)-2-methoxycarbonylmethoxyiminothioacetate's intricate structure and diverse functional groups suggest its potential utility in various fields such as pharmaceuticals, biotechnology, and materials science.
Uses
Used in Pharmaceutical Industry:
(S)-2-Benzothiazolyl (Z)-2-(2-aminothiazole-4-yl)-2-methoxycarbonylmethoxyiminothioacetate is used as a pharmaceutical intermediate for the synthesis of various therapeutic agents. Its unique structure and functional groups may contribute to the development of new drugs with specific targeting or activity profiles, potentially leading to improved treatments for a range of diseases.
Used in Biotechnology:
In the biotechnology sector, (S)-2-Benzothiazolyl (Z)-2-(2-aminothiazole-4-yl)-2-methoxycarbonylmethoxyiminothioacetate may serve as a key component in the design of novel bioactive molecules. Its complex structure could be leveraged to create compounds with specific binding affinities or catalytic properties, useful in areas such as enzyme inhibition, molecular recognition, or as components of biosensors.
Used in Materials Science:
(S)-2-Benzothiazolyl (Z)-2-(2-aminothiazole-4-yl)-2-methoxycarbonylmethoxyiminothioacetate is used as a building block in the development of advanced materials with tailored properties. Its incorporation into polymers or other materials could lead to new classes of materials with improved characteristics such as enhanced stability, specific binding capabilities, or unique optical, electronic, or mechanical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 246035-38-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,6,0,3 and 5 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 246035-38:
(8*2)+(7*4)+(6*6)+(5*0)+(4*3)+(3*5)+(2*3)+(1*8)=121
121 % 10 = 1
So 246035-38-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H12N4O4S3/c1-22-11(20)6-23-19-12(9-7-24-14(16)17-9)13(21)26-15-18-8-4-2-3-5-10(8)25-15/h2-5,7H,6H2,1H3,(H2,16,17)/b19-12-
246035-38-1Relevant articles and documents
AN IMPROVED PROCESS FOR THE PREPARATION OF CEFIXIME
-
Page/Page column 9, (2008/06/13)
There is provided an improved process for preparing cefixime. Thus, for example, 7-amino-3-vinyl-3-cephem-4-carboxylic acid is reacted with 2-mercapto-1,3-benzothiazolyl-(Z)-2-(2-aminothiazol-4-yl)-2-(methoxycarbonyl)-methoxyimino acetate in tetrahydrofuran and water at 4°C in the presence of triethylamine. The reaction mass is extracted with ethyl acetate. 7-[2-(2-Amino-4-thiazolyl)-2-(methoxycarbonylmethoxyimino)acetamido]-3-vinyl-3-cephem-4-carboxylic acid triethylamine salt present in the aqueous layer is hydrolyzed with sodium hydroxide in less than 30 minutes and aqueous hydrochloric acid is added immediately to adjust the pH to 4.8 to 5.2. Then, aqueous hydrochloric acid is added at 35°C to adjust the pH 2.5 and cooled to crystallize cefixime trihydrate in high purity.