246543-68-0 Usage
General Description
8-Oxabicyclo[3.2.1]octane-3-carboxylic acid, 3-amino, ethyl ester (9CI) is a chemical compound with the molecular formula C9H15NO3. It is an ethyl ester derivative of bicyclic amino carboxylic acid, containing a three-carbon bridge. 8-Oxabicyclo[3.2.1]octane-3-carboxylicacid,3-amino-,ethylester(9CI) has potential applications in the field of medicinal chemistry and drug discovery due to its unique chemical structure and potential biological activities. However, further research is needed to understand its full range of properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 246543-68-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,6,5,4 and 3 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 246543-68:
(8*2)+(7*4)+(6*6)+(5*5)+(4*4)+(3*3)+(2*6)+(1*8)=150
150 % 10 = 0
So 246543-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H17NO3/c1-2-13-9(12)10(11)5-7-3-4-8(6-10)14-7/h7-8H,2-6,11H2,1H3