247088-99-9 Usage
Description
2-(2-METHYL-IMIDAZOLE-1-CARBONYL)-BENZOIC ACID is a chemical compound characterized by its molecular formula C14H12N2O3. It is a derivative of benzoic acid, featuring a carbonyl group attached to a 2-methyl-imidazole ring. 2-(2-METHYL-IMIDAZOLE-1-CARBONYL)-BENZOIC ACID is known for its structural and functional versatility, making it a valuable component in pharmaceutical development and medicinal chemistry research.
Uses
Used in Pharmaceutical Industry:
2-(2-METHYL-IMIDAZOLE-1-CARBONYL)-BENZOIC ACID is utilized as a building block for the synthesis of various drugs and active pharmaceutical ingredients. Its unique structure and properties contribute to the development of new therapeutic agents, enhancing the range of available treatments for different medical conditions.
Used in Drug Development:
In the realm of drug development, 2-(2-METHYL-IMIDAZOLE-1-CARBONYL)-BENZOIC ACID serves as a key component in the creation of novel pharmaceuticals. Its chemical properties allow for the design of molecules with specific therapeutic effects, addressing unmet medical needs and improving patient outcomes.
Used in Medicinal Chemistry Research:
2-(2-METHYL-IMIDAZOLE-1-CARBONYL)-BENZOIC ACID is also employed in medicinal chemistry research, where it is studied for its potential to influence biological processes and pathways. This research helps to uncover new mechanisms of action and therapeutic targets, paving the way for the discovery of innovative drugs and treatment strategies.
Check Digit Verification of cas no
The CAS Registry Mumber 247088-99-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,7,0,8 and 8 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 247088-99:
(8*2)+(7*4)+(6*7)+(5*0)+(4*8)+(3*8)+(2*9)+(1*9)=169
169 % 10 = 9
So 247088-99-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H10N2O3/c1-8-13-6-7-14(8)11(15)9-4-2-3-5-10(9)12(16)17/h2-7H,1H3,(H,16,17)/p-1
