247184-07-2 Usage
Description
5-Amino-4-o-tolyl-1,2-dihydro-pyrazol-3-one is a pyrazolinone derivative, which is a type of organic compound characterized by a pyrazolone ring fused with a dihydro structure. It is known for its potential applications in various industries due to its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
5-Amino-4-o-tolyl-1,2-dihydro-pyrazol-3-one is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a versatile component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
In the field of chemical synthesis, 5-Amino-4-o-tolyl-1,2-dihydro-pyrazol-3-one serves as an important intermediate for the creation of a wide range of chemical products. Its reactivity and structural features make it a valuable asset in the synthesis of complex molecules with specific applications.
Used in Research and Development:
5-Amino-4-o-tolyl-1,2-dihydro-pyrazol-3-one is also utilized in research and development settings, where it can be employed to study the properties and behavior of pyrazolinone derivatives. This knowledge can then be applied to the design and development of new compounds with tailored properties for various applications.
Overall, 5-Amino-4-o-tolyl-1,2-dihydro-pyrazol-3-one is a versatile compound with a range of potential applications across different industries, particularly in the pharmaceutical, chemical synthesis, and research sectors. Its unique structure and properties make it a valuable building block for the development of new drugs, chemical products, and scientific insights.
Check Digit Verification of cas no
The CAS Registry Mumber 247184-07-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,7,1,8 and 4 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 247184-07:
(8*2)+(7*4)+(6*7)+(5*1)+(4*8)+(3*4)+(2*0)+(1*7)=142
142 % 10 = 2
So 247184-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O/c1-6-4-2-3-5-7(6)8-9(11)12-13-10(8)14/h2-5H,1H3,(H4,11,12,13,14)
