2473-16-7 Usage
Uses
Used in Antimicrobial Applications:
2,5,7,8-Tetrahydroxy-1,4-naphthoquinone is used as an antimicrobial agent for its ability to inhibit the growth of various microorganisms, including bacteria and fungi. Its chemical structure allows it to interact with cellular components, disrupting essential processes and leading to the inactivation of the target organisms.
Used in Antifungal Applications:
In the field of antifungal applications, 2,5,7,8-Tetrahydroxy-1,4-naphthoquinone is utilized for its effectiveness against fungal infections. It demonstrates the potential to treat a variety of fungal diseases by interfering with fungal cell metabolism and inhibiting their growth, thus providing a valuable alternative to conventional antifungal treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 2473-16-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,7 and 3 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2473-16:
(6*2)+(5*4)+(4*7)+(3*3)+(2*1)+(1*6)=77
77 % 10 = 7
So 2473-16-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H6O6/c11-3-1-5(13)9(15)8-7(3)4(12)2-6(14)10(8)16/h1-2,11-13,15H
2473-16-7Relevant academic research and scientific papers
The chemistry of naphthazarin derivatives 4. A simple preparative synthesis of mompain
Malinovskaya,Chizkova,Anufriev
, p. 1010 - 1011 (2007/10/03)
Direct oxidation of naphthazarin with manganese dioxide in cone. H2SO4 was found to be a simple and effective method for the synthesis of mompain.
