247564-57-4 Usage
Uses
Used in Pharmaceutical Industry:
4,6-Difluorooxindole is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique molecular structure, including the presence of fluorine atoms, contributes to the development of new drugs with improved stability and potency.
Used in Medical Research:
4,6-Difluorooxindole is employed as a research tool in the field of medicinal chemistry. It aids in understanding the interactions between molecules and their biological targets, which is crucial for the discovery of new therapeutic agents.
Used in Drug Development:
4,6-Difluorooxindole is used as a building block in the design and development of novel drug candidates. Its structural features can be exploited to create molecules with enhanced biological activity and selectivity, potentially leading to more effective treatments for various diseases.
Used in Chemical Synthesis:
4,6-Difluorooxindole serves as a key component in the synthesis of complex organic molecules. Its reactivity and stability make it a valuable precursor in the preparation of a wide range of chemical products, including specialty chemicals and advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 247564-57-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,4,7,5,6 and 4 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 247564-57:
(8*2)+(7*4)+(6*7)+(5*5)+(4*6)+(3*4)+(2*5)+(1*7)=164
164 % 10 = 4
So 247564-57-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H5F2NO/c9-4-1-6(10)5-3-8(12)11-7(5)2-4/h1-2H,3H2,(H,11,12)
