24910-11-0 Usage
Uses
Used in Pharmaceutical Industry:
3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure and reactivity may contribute to the development of new drugs with specific targeting and efficacy profiles.
Used in Agrochemical Industry:
In the agrochemical sector, 3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE is utilized as a chemical intermediate or active ingredient in the synthesis of pesticides or other agrochemical products. Its diverse chemical properties allow for the creation of novel compounds with improved performance and selectivity.
Used in Materials Science:
3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE serves as a key component in the development of advanced materials with specific properties. Its incorporation into polymers, coatings, or other materials can enhance their performance, durability, or functionality.
Further research and study are essential to fully explore the potential of 3,9-DIAZA-SPIRO[5.5]UNDECANE-2,4-DIONE in these industries and uncover additional applications where its unique properties can be leveraged for innovative solutions.
Check Digit Verification of cas no
The CAS Registry Mumber 24910-11-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,9,1 and 0 respectively; the second part has 2 digits, 1 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 24910-11:
(7*2)+(6*4)+(5*9)+(4*1)+(3*0)+(2*1)+(1*1)=90
90 % 10 = 0
So 24910-11-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O2/c12-7-5-9(6-8(13)11-7)1-3-10-4-2-9/h10H,1-6H2,(H,11,12,13)
