24933-59-3 Usage
Uses
Used in Organic Synthesis:
3-Difluoromethylsulfanyl-phenylamine is utilized as a reagent in organic synthesis for the introduction of the difluoromethylsulfanyl group into a range of molecules. Its reactivity allows for the creation of new compounds with specific properties, making it a valuable tool in the synthesis process.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, 3-difluoromethylsulfanyl-phenylamine serves as a key intermediate in the synthesis of biologically active compounds. Its incorporation into drug molecules can enhance their therapeutic effects and selectivity, contributing to the development of novel medications.
Used in Agrochemical Development:
3-Difluoromethylsulfanyl-phenylamine also finds application in the agrochemical industry, where it is used in the synthesis of compounds with pesticidal or herbicidal properties. Its unique functional groups can impart increased efficacy and selectivity to these agrochemicals.
Used in Material Science:
Furthermore, 3-difluoromethylsulfanyl-phenylamine can be employed as a building block in the synthesis of materials with specialized characteristics, such as liquid crystals or polymers. Its ability to influence the physical and chemical properties of these materials makes it a promising candidate for high-tech applications.
Check Digit Verification of cas no
The CAS Registry Mumber 24933-59-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,4,9,3 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 24933-59:
(7*2)+(6*4)+(5*9)+(4*3)+(3*3)+(2*5)+(1*9)=123
123 % 10 = 3
So 24933-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H7F2NS/c8-7(9)11-6-3-1-2-5(10)4-6/h1-4,7H,10H2
