2498-03-5 Usage
Chemical class
Pyrrolidine-2,5-dione derivatives
Structural features
Ethyl group attached to the amino group
M-tolyl group attached to the pyrrolidine ring
Potential psychoactivity
Likely due to the presence of the ethyl substituent
Potential neurotoxicity
Possible due to the ethyl substituent
Pharmacological properties
Unknown, but may have potential for drug development
Research status
Further research needed to understand effects and applications
Handling precautions
Caution advised due to potential risks to human health and environment
Check Digit Verification of cas no
The CAS Registry Mumber 2498-03-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,4,9 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 2498-03:
(6*2)+(5*4)+(4*9)+(3*8)+(2*0)+(1*3)=95
95 % 10 = 5
So 2498-03-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H20N2O2/c1-3-16(13-6-4-5-12(2)11-13)9-10-17-14(18)7-8-15(17)19/h4-6,11H,3,7-10H2,1-2H3
