25016-19-7 Usage
Uses
Used in Pharmaceutical Industry:
Methyl 1,3,5-triMethyl-1H-pyrazole-4-carboxylate is used as a building block in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
In the agrochemical industry, Methyl 1,3,5-triMethyl-1H-pyrazole-4-carboxylate serves as a key component in the production of various agrochemicals, contributing to the development of effective pest control and crop protection solutions.
Used in Material Science:
Methyl 1,3,5-triMethyl-1H-pyrazole-4-carboxylate is utilized in the development of new materials due to its unique chemical properties. Its versatility allows for the creation of materials with specific characteristics, such as improved stability or enhanced reactivity.
Used in Coordination Chemistry:
As a ligand in coordination chemistry, Methyl 1,3,5-triMethyl-1H-pyrazole-4-carboxylate plays a crucial role in the formation of coordination complexes. These complexes have potential applications in various fields, including catalysis, sensing, and molecular recognition.
Used in Enzyme Inhibition Studies:
Methyl 1,3,5-triMethyl-1H-pyrazole-4-carboxylate has been studied for its potential biological activities, particularly its ability to inhibit certain enzymes. This property makes it a valuable compound in the development of enzyme-targeting drugs and therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 25016-19-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,0,1 and 6 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 25016-19:
(7*2)+(6*5)+(5*0)+(4*1)+(3*6)+(2*1)+(1*9)=77
77 % 10 = 7
So 25016-19-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H12N2O2/c1-5-7(8(11)12-4)6(2)10(3)9-5/h1-4H3
25016-19-7Relevant academic research and scientific papers
Synthetic method for 1,3,5-trimethyl-4-pyrazole methyl formate
-
, (2017/02/02)
The invention relates to a synthetic method for 1,3,5-trimethyl-4-pyrazole methyl formate, which belongs to the field of chemical synthesis. The synthetic method comprises the following steps: subjecting trichloroacetonitrile, methanol and methyl cyanoacetate to a reaction so as to prepare a white crystal; then adding hydrazine hydrate drop by drop and carrying outoxidation; continuing adding a sodium nitrite solution drop by drop, carrying out a reaction under stirring and collecting a reaction solution; curing the reaction solution, adding dimethyl sulphate drop by drop and introducing a sodium bicarbonate solution to adjust a pH value to 7.5 to 8.0; carrying out repeated extraction with dichloromethane and combining organic layers; then carrying out rotary evaporation and collecting a red waxy solid; and reacting the red waxy solid with nitromethane at 65 to 70 DEG C under stirring so as to prepare 1,3,5-trimethyl-4-pyrazole methyl formate.
