25026-64-6 Usage
Uses
Used in Pharmaceutical Industry:
3-Chloro-5-fluorobenzoic acid is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure allows it to be a key component in the development of medications with specific therapeutic properties.
Used in Chemical Research:
3-Chloro-5-fluorobenzoic acid also serves as a protective reagent in chemical research. Its ability to form stable derivatives with other compounds makes it an essential tool for protecting functional groups during chemical reactions, facilitating the synthesis of complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 25026-64-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,0,2 and 6 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 25026-64:
(7*2)+(6*5)+(5*0)+(4*2)+(3*6)+(2*6)+(1*4)=86
86 % 10 = 6
So 25026-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4ClFO2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11)/p-1
25026-64-6Relevant academic research and scientific papers
Heteropolycyclic compounds and their use as metabotropic glutamate receptor antagonists
-
, (2008/06/13)
The present invention provides compounds and pharmaceutical compositions that act as antagonists at metabotropic glutamate receptors, and that are useful for treating neurological diseases and disorders. Methods of preparing the compounds also are disclosed.
