25047-90-9 Usage
Uses
Used in Pharmaceutical Research:
3-((2-(Benzoyloxy)ethyl)phenylamino)propiononitrile is used as an intermediate in pharmaceutical research for its potential applications in drug development. Its unique structure allows it to be a building block for the synthesis of other organic compounds, contributing to the creation of new pharmaceutical agents.
Used in Organic Synthesis:
In the field of organic synthesis, 3-((2-(Benzoyloxy)ethyl)phenylamino)propiononitrile serves as a valuable intermediate. Its presence of a benzoyloxy group, ethyl group, and amino group makes it a useful component in the synthesis of various organic compounds, expanding the scope of chemical reactions and products that can be achieved.
Used in Chemical Industry:
3-((2-(Benzoyloxy)ethyl)phenylamino)propiononitrile is utilized in the chemical industry for its versatility and potential to be incorporated into a wide range of chemical processes. Its ability to participate in various reactions makes it a valuable asset in the development of new materials and compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 25047-90-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,0,4 and 7 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 25047-90:
(7*2)+(6*5)+(5*0)+(4*4)+(3*7)+(2*9)+(1*0)=99
99 % 10 = 9
So 25047-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H18N2O2/c19-12-7-13-20(17-10-5-2-6-11-17)14-15-22-18(21)16-8-3-1-4-9-16/h1-6,8-11H,7,13-15H2
