251101-36-7 Usage
Uses
Used in Pharmaceutical Industry:
3-Methyl-Pyridine-4-Carboxamide is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its role in the industry is crucial, as it can contribute to the development of new drugs and medications.
Used in Chemical Industry:
3-Methyl-Pyridine-4-Carboxamide is used as a reagent in various chemical reactions, aiding in the production of different organic products. Its versatility in chemical processes makes it a valuable component in the synthesis of a wide range of chemical substances.
Check Digit Verification of cas no
The CAS Registry Mumber 251101-36-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,1,1,0 and 1 respectively; the second part has 2 digits, 3 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 251101-36:
(8*2)+(7*5)+(6*1)+(5*1)+(4*0)+(3*1)+(2*3)+(1*6)=77
77 % 10 = 7
So 251101-36-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O/c1-5-4-9-3-2-6(5)7(8)10/h2-4H,1H3,(H2,8,10)
