25121-81-7 Usage
Uses
Used in Organic Synthesis:
2-Bromothieno[2,3-b]thiophene is utilized as a key intermediate in organic synthesis for the creation of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the synthesis of complex organic molecules.
Used in Material Science:
In the realm of material science, 2-Bromothieno[2,3-b]thiophene is employed as a component in the development of organic electronic devices. Its properties contribute to the performance and efficiency of these devices.
Used in Organic Electronic Devices:
2-Bromothieno[2,3-b]thiophene is used as a crucial component in the fabrication of organic light-emitting diodes (OLEDs). Its incorporation enhances the device's light-emitting properties, contributing to improved display technologies.
Used in Organic Photovoltaics:
2-Bromothieno[2,3-b]thiophene also finds application in organic photovoltaics (OPVs), where it plays a role in the conversion of light into electricity, thereby contributing to the advancement of solar energy technologies.
Used in Pharmaceutical Industry:
2-Bromothieno[2,3-b]thiophene is used as a building block for the synthesis of pharmaceutical compounds. Its unique structure and reactivity make it a promising candidate for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
Similarly, in the agrochemical industry, 2-Bromothieno[2,3-b]thiophene is employed in the synthesis of various agrochemicals, including pesticides and herbicides, where its properties can be harnessed to improve the effectiveness of these products.
Check Digit Verification of cas no
The CAS Registry Mumber 25121-81-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,1,2 and 1 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25121-81:
(7*2)+(6*5)+(5*1)+(4*2)+(3*1)+(2*8)+(1*1)=77
77 % 10 = 7
So 25121-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H3BrS2/c7-5-3-4-1-2-8-6(4)9-5/h1-3H
