25198-98-5 Usage
Uses
Used in Organic Synthesis:
5-Ethylpyrimidin-4-ol is used as an intermediate in organic synthesis for the production of various chemical compounds. Its reactivity and functional groups allow for the formation of a wide range of derivatives, making it a valuable building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Research:
5-Ethylpyrimidin-4-ol is used as a starting material in pharmaceutical research for the development of new drugs. Its unique chemical structure and potential biological activity make it a promising candidate for the discovery of novel therapeutic agents. Researchers can modify its structure to explore its potential as a drug lead compound for the treatment of various diseases.
Used in Agrochemical Development:
5-Ethylpyrimidin-4-ol has potential applications in the development of agrochemicals, such as pesticides and herbicides. Its unique chemical properties and reactivity can be harnessed to create new compounds with improved efficacy and selectivity in controlling pests and weeds.
Used in Drug Lead Compound Identification:
Due to its potential biological activity, 5-ethylpyrimidin-4-ol can be used as a drug lead compound in the early stages of drug discovery. Researchers can screen its activity against various biological targets to identify its potential therapeutic applications and further optimize its structure for improved potency and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 25198-98-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,1,9 and 8 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 25198-98:
(7*2)+(6*5)+(5*1)+(4*9)+(3*8)+(2*9)+(1*8)=135
135 % 10 = 5
So 25198-98-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-2-5-3-7-4-8-6(5)9/h3-4H,2H2,1H3,(H,7,8,9)
25198-98-5Relevant academic research and scientific papers
2-(3-Amino-2-hydroxy-propoxy)-mono-and diazines
-
, (2008/06/13)
Heterocyclic compounds of the formula STR1 wherein Het denotes optionally substituted pyridazinyl, pyrimidinyl, pyrazinyl or substituted pyridyl, R1 is hydrogen or methyl and R2 is lower alklyl, optionally substituted phenyl-lower alkyl, carboxy-lower alkyl or functionally modified carboxy-lower alkyl, their condensation products with aldehydes, ketones or carbonic acid and their N-oxides, which are valuable (cardioselective) β-receptor blocking agents, and/or (cardioselective) β-receptor-stimulants.
2-(3-AMINO-2-HYDROXY-PROPOXY)-PYRAZINES
-
, (2008/06/13)
Heterocyclic compounds of the formula STR1 wherein Het denotes optionally substituted pyridazinyl, pyrimidinyl, pyrazinyl or substituted pyridyl, R 1 is hydrogen or methyl and R 2 is lower alkyl, optionally substituted phenyl-lower alkyl, carboxy-lower alkyl or functionally modified carboxy-lower alkyl, their condensation products with aldehydes, ketones or carbonic acid and their N-oxides, which are valuable (cardioselective) β-rezeptor blocking agents, and/or (cardioselective) β-rezeptor-stimulants.
