25233-50-5 Usage
Uses
Used in Pharmaceutical Industry:
N-(5-CHLORO-2-METHYL-PHENYL)-3-OXO-BUTYRAMIDE is used as a pharmaceutical intermediate for the synthesis of various drugs. Its unique structure and reactivity make it a valuable building block in the development of new therapeutic agents.
Used in Chemical Synthesis:
N-(5-CHLORO-2-METHYL-PHENYL)-3-OXO-BUTYRAMIDE is used as a key intermediate in the synthesis of various organic compounds. Its chloro and methyl groups on the phenyl ring provide opportunities for further functionalization and modification, making it a versatile component in organic chemistry.
Used in Research and Development:
N-(5-CHLORO-2-METHYL-PHENYL)-3-OXO-BUTYRAMIDE is used as a research compound in academic and industrial laboratories. Its unique properties and reactivity make it an interesting subject for studying chemical reactions and exploring new applications in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 25233-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,2,3 and 3 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 25233-50:
(7*2)+(6*5)+(5*2)+(4*3)+(3*3)+(2*5)+(1*0)=85
85 % 10 = 5
So 25233-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H12ClNO2/c1-7-3-4-9(12)6-10(7)13-11(15)5-8(2)14/h3-4,6H,5H2,1-2H3,(H,13,15)
