25264-26-0 Usage
Chemical compound
A substance formed from two or more elements chemically bonded together in a fixed proportion.
Used in manufacturing
It is utilized in the production process of various products.
Dyes and pigments
Colorants used to impart color to different materials.
Anthraquinone family
A group of chemical compounds known for their intense color and high stability.
Dimethylamino and methylamino groups
These are functional groups present in the compound that contribute to its properties.
Building block
A fundamental component used to create more complex structures.
Textile industry
The industry that produces textiles, such as fabrics and fibers.
Dyeing fabrics
The process of applying color to textiles using dyes.
Distinct chemical structure
The unique arrangement of atoms and bonds in the compound that gives it specific properties.
Bright and durable coloration
The ability to produce vivid and long-lasting colors in various materials.
Check Digit Verification of cas no
The CAS Registry Mumber 25264-26-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,2,6 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 25264-26:
(7*2)+(6*5)+(5*2)+(4*6)+(3*4)+(2*2)+(1*6)=100
100 % 10 = 0
So 25264-26-0 is a valid CAS Registry Number.
InChI:InChI=1/C20H23N3O2/c1-21-15-9-10-16(22-11-6-12-23(2)3)18-17(15)19(24)13-7-4-5-8-14(13)20(18)25/h4-5,7-10,21-22H,6,11-12H2,1-3H3