25265-78-5 Usage
Uses
Used in Detergent Industry:
DODECYLBENZENE is used as a raw material for the production of common detergents. The reason for its use is that it can be sulfonated, and the sodium salt of the resulting sulfonic acid is a key component in the formulation of these detergents, providing effective cleaning properties.
Used in Chemical Industry:
DODECYLBENZENE is used as an intermediate in the chemical industry for the synthesis of various compounds and materials. Its unique structure allows it to be a versatile building block in the creation of different products, such as surfactants, lubricants, and additives.
Used in Pharmaceutical Industry:
DODECYLBENZENE can be utilized as a starting material for the synthesis of pharmaceutical compounds. Its chemical properties make it suitable for the development of new drugs and therapeutic agents, potentially contributing to advancements in medicine.
Used in Polymer Industry:
In the polymer industry, DODECYLBENZENE can be employed as a component in the production of specific types of polymers. Its hydrophobic nature and compatibility with other monomers make it a valuable addition to the development of new polymer materials with tailored properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 25265-78-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,2,6 and 5 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 25265-78:
(7*2)+(6*5)+(5*2)+(4*6)+(3*5)+(2*7)+(1*8)=115
115 % 10 = 5
So 25265-78-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H30/c1-5-9-15-13-16(10-6-2)18(12-8-4)17(14-15)11-7-3/h13-14H,5-12H2,1-4H3