25288-49-7 Usage
Type of chemical
synthetic auxin herbicide
Use
control broadleaf weeds in various crops
Mode of action
disrupts normal growth and development of plants, leading to death
Solubility
highly soluble in water
Volatility
low, making it persistent in the environment
Toxicity
relatively low to humans and animals, but can cause skin and eye irritation upon direct contact
Controversy
potential to drift and cause damage to sensitive crops, subject of regulatory scrutiny
Check Digit Verification of cas no
The CAS Registry Mumber 25288-49-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,2,8 and 8 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 25288-49:
(7*2)+(6*5)+(5*2)+(4*8)+(3*8)+(2*4)+(1*9)=127
127 % 10 = 7
So 25288-49-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H10Cl2N2O2/c14-9-3-4-12(11(15)6-9)19-8-13(18)17-10-2-1-5-16-7-10/h1-7H,8H2,(H,17,18)
