25296-54-2 Usage
General Description
PHENOLPHTHALEIN COMPLEXONE is a complex organic compound that is commonly used in analytical chemistry as a chelating agent. It has a high affinity for metal ions, particularly calcium, magnesium, and other heavy metals, and is often used as a titrant in complexometric titrations to determine the concentration of these metals in a given sample. The compound is known for its vibrant pink color in alkaline solutions, making it a popular indicator in acid-base titrations. It also has a wide range of industrial applications, including in the production of dyes, pigments, and pharmaceuticals. Due to its effectiveness as a chelating agent, PHENOLPHTHALEIN COMPLEXONE is a versatile and important chemical in various fields of science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 25296-54-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,2,9 and 6 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 25296-54:
(7*2)+(6*5)+(5*2)+(4*9)+(3*6)+(2*5)+(1*4)=122
122 % 10 = 2
So 25296-54-2 is a valid CAS Registry Number.
InChI:InChI=1/C20H14O4.C10H16N2O8.4Na/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20;13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;;;/h1-12,21-22H;1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;;;/q;;4*+1/p-4