25300-73-6 Usage
Main properties
1. Polymer structure: formed by polymerizing 2-Propenoic acid, 2-methyl-, methyl ester with 2-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethyl 2-methyl-2-propenoate
2. Application: lubricant additive, production of adhesives, formulation of coatings and inks, binder in manufacturing
3. Unique properties: enhanced performance due to incorporation of 2-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethyl 2-methyl-2-propenoate
4. Tailorable structure: can be modified to meet specific industry requirements
Specific content
1. Chemical name: 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 2-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethyl 2-methyl-2-propenoate
2. Formation: polymerized form of 2-Propenoic acid, 2-methyl-, methyl ester with 2-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethyl 2-methyl-2-propenoate
3. Applications: lubricant additive, adhesive production, coatings and inks formulation, binder in manufacturing
4. Performance enhancement: unique properties from 2-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethyl 2-methyl-2-propenoate component
5. Customizability: structure and composition can be tailored for specific industry needs.
Check Digit Verification of cas no
The CAS Registry Mumber 25300-73-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,3,0 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 25300-73:
(7*2)+(6*5)+(5*3)+(4*0)+(3*0)+(2*7)+(1*3)=76
76 % 10 = 6
So 25300-73-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H23NO3.C5H8O2/c1-12(2)13(16)17-10-8-15-9-11-18-14(15)6-4-3-5-7-14;1-4(2)5(6)7-3/h1,3-11H2,2H3;1H2,2-3H3