253340-48-6 Usage
Uses
Used in Pharmaceutical Industry:
4(1H)-Pyrimidinone, 2-amino-6-(hydroxymethyl)(9CI) is used as a pharmaceutical intermediate for the synthesis of various drugs. Its presence of amino and hydroxymethyl groups allows for the creation of a wide range of biologically active compounds, making it a valuable component in drug development.
Used in Chemical Research:
In the field of chemical research, 4(1H)-Pyrimidinone, 2-amino-6-(hydroxymethyl)(9CI) is used as a model compound for studying the properties and reactions of pyrimidinone derivatives. Its unique structure and functional groups provide insights into the behavior of similar compounds, contributing to the advancement of chemical knowledge.
Used in Biological Applications:
4(1H)-Pyrimidinone, 2-amino-6-(hydroxymethyl)(9CI) is employed in biological applications, such as in the development of new bioactive molecules. Its functional groups can be utilized to create compounds with potential therapeutic effects, making it a valuable resource in the search for new treatments and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 253340-48-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,3,3,4 and 0 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 253340-48:
(8*2)+(7*5)+(6*3)+(5*3)+(4*4)+(3*0)+(2*4)+(1*8)=116
116 % 10 = 6
So 253340-48-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c6-5-7-3(2-9)1-4(10)8-5/h1,9H,2H2,(H3,6,7,8,10)
