25357-03-3 Usage
Molecular weight
261.35 g/mol
Insoluble in water
Used as a reagent in organic synthesis
Commonly employed as a chelating agent for metal ions
Studied for potential pharmaceutical applications
Particularly researched as a potential anticancer agent
Versatile compound with potential uses in chemical and pharmaceutical industries
Check Digit Verification of cas no
The CAS Registry Mumber 25357-03-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,3,5 and 7 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 25357-03:
(7*2)+(6*5)+(5*3)+(4*5)+(3*7)+(2*0)+(1*3)=103
103 % 10 = 3
So 25357-03-3 is a valid CAS Registry Number.
InChI:InChI=1/C15H21NO4/c1-3-5-10-20-13-8-6-12(7-9-15(17)16-18)11-14(13)19-4-2/h6-9,11,18H,3-5,10H2,1-2H3,(H,16,17)/b9-7+