25468-53-5 Usage
Uses
Used in Pharmaceutical Industry:
ETHYL 2-CYANO-3-ETHOXY-2-PENTENOATE is used as a key intermediate in the synthesis of various pharmaceuticals. Its high reactivity allows for the creation of complex organic molecules, contributing to the development of new and innovative medications.
Used in Agrochemical Industry:
In the agrochemical industry, ETHYL 2-CYANO-3-ETHOXY-2-PENTENOATE serves as a crucial component in the production of various agrochemicals. Its role in organic synthesis enables the creation of effective compounds for agricultural applications, such as pesticides and herbicides.
Used in Fine Chemicals Industry:
ETHYL 2-CYANO-3-ETHOXY-2-PENTENOATE is utilized as a building block in the synthesis of fine chemicals, which are high-purity chemicals used in various applications, including research, pharmaceuticals, and specialty industries. Its versatility and reactivity make it an essential component in the production of these high-quality chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 25468-53-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,4,6 and 8 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 25468-53:
(7*2)+(6*5)+(5*4)+(4*6)+(3*8)+(2*5)+(1*3)=125
125 % 10 = 5
So 25468-53-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO3/c1-4-9(13-5-2)8(7-11)10(12)14-6-3/h4-6H2,1-3H3
