255828-29-6 Usage
Description
METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE, a chemical compound with the molecular formula C12H8O4S, is a thiophene derivative featuring a furan ring and a formyl group. METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE is recognized for its potential medicinal properties, such as anti-inflammatory and antioxidant capabilities, and is primarily utilized as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds.
Uses
Used in Pharmaceutical Industry:
METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE is used as a chemical intermediate for the synthesis of various pharmaceuticals, contributing to the development of new medications due to its unique structural features and potential medicinal properties.
Used in Agrochemical Industry:
In the agrochemical sector, METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE serves as an intermediate in the production of agrochemicals, potentially enhancing crop protection and yield through its incorporation into novel compounds.
Used in Organic Compounds Synthesis:
METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE is utilized as a key intermediate in the synthesis of a range of organic compounds, facilitating the creation of diverse chemical entities for various applications.
Used as a Potential Anti-Inflammatory Agent:
METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE is studied for its potential as an anti-inflammatory agent, suggesting its use in the development of treatments for inflammatory conditions.
Used as a Potential Antioxidant Agent:
METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE is also being investigated for its antioxidant potential, indicating its possible application in therapeutics aimed at combating oxidative stress-related diseases.
METHYL 3-(5-FORMYL-2-FURYL)THIOPHENE-2-CARBOXYLATE is typically handled and stored following standard laboratory practices for organic compounds to ensure safety and stability.
Check Digit Verification of cas no
The CAS Registry Mumber 255828-29-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,5,8,2 and 8 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 255828-29:
(8*2)+(7*5)+(6*5)+(5*8)+(4*2)+(3*8)+(2*2)+(1*9)=166
166 % 10 = 6
So 255828-29-6 is a valid CAS Registry Number.
InChI:InChI=1/C11H8O4S/c1-14-11(13)10-8(4-5-16-10)9-3-2-7(6-12)15-9/h2-6H,1H3
