25620-58-0 Usage
Uses
Used in Chemical Synthesis:
1,6-DIAMINO-2,2,4(2,4,4)-TRIMETHYLHEXANE is used as a chemical intermediate for the production of various chemicals. Its unique structure allows it to be a versatile building block in the creation of different compounds, contributing to its significance in the chemical industry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,6-DIAMINO-2,2,4(2,4,4)-TRIMETHYLHEXANE is used as a starting material for the synthesis of various pharmaceutical compounds. Its reactivity and structural properties make it a valuable component in the development of new drugs and medications.
Used in Industrial Applications:
1,6-DIAMINO-2,2,4(2,4,4)-TRIMETHYLHEXANE is also utilized in various industrial applications, such as the production of additives, coatings, and other specialty chemicals. Its ability to form a wide range of derivatives makes it a valuable asset in the development of new materials and products for various industries.
Used in Research and Development:
Due to its unique chemical properties, 1,6-DIAMINO-2,2,4(2,4,4)-TRIMETHYLHEXANE is often employed in research and development settings. Scientists and researchers use 1,6-DIAMINO-2,2,4(2,4,4)-TRIMETHYLHEXANE to explore new chemical reactions, develop novel synthetic methods, and create innovative materials with potential applications in various fields.
Air & Water Reactions
Insoluble in water.
Reactivity Profile
Amines, such as TRIMETHYLHEXAMETHYLENEDIAMINE, are chemical bases. They neutralize acids to form salts plus water. These acid-base reactions are exothermic. The amount of heat that is evolved per mole of amine in a neutralization is largely independent of the strength of the amine as a base. Amines may be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen is generated by amines in combination with strong reducing agents, such as hydrides.
Health Hazard
INHALATION: Irritating to mucous membranes. EYES and SKIN: Irritation. INGESTION: May be harmful if swallowed.
Check Digit Verification of cas no
The CAS Registry Mumber 25620-58-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,6,2 and 0 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 25620-58:
(7*2)+(6*5)+(5*6)+(4*2)+(3*0)+(2*5)+(1*8)=100
100 % 10 = 0
So 25620-58-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H22N2/c1-10-8-6-4-5-7-9-11(2)3/h10H,4-9H2,1-3H3
