25625-62-1 Usage
Uses
Used in Pharmaceutical Industry:
6-Methylquinoxaline-2,3-dithiol serves as an intermediate in the synthesis of a range of organic compounds, particularly in the development of pharmaceuticals. Its ability to participate in diverse chemical reactions makes it a valuable component in creating new drug molecules, potentially leading to advancements in medicinal chemistry.
Used in Agricultural Industry:
In the agricultural sector, 6-Methylquinoxaline-2,3-dithiol finds applications in the production of various agrochemicals. Its role as an intermediate allows for the synthesis of compounds that can be used in pest control, crop protection, and other agricultural applications, thereby contributing to more effective and sustainable farming practices.
Used as a Chemical Intermediate:
6-Methylquinoxaline-2,3-dithiol is utilized as a chemical intermediate for the synthesis of a variety of organic compounds. Its presence in the molecular structure of target compounds is crucial for achieving desired properties and functions, such as reactivity, stability, or biological activity. This makes it an essential component in the development of new chemical entities across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 25625-62-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,6,2 and 5 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 25625-62:
(7*2)+(6*5)+(5*6)+(4*2)+(3*5)+(2*6)+(1*2)=111
111 % 10 = 1
So 25625-62-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H8N2S2/c1-5-2-3-6-7(4-5)11-9(13)8(12)10-6/h2-4H,1H3,(H,10,12)(H,11,13)
25625-62-1Relevant academic research and scientific papers
Synthesis of novel diphenylamine-based fluorescent styryl colorants and study of their thermal, photophysical, and electrochemical properties
Sonawane, Yogesh A.,Rajule, Rajkumar N.,Shankarling, Ganapati S.
, p. 1145 - 1151 (2012/07/13)
Three novel "Y"-shaped acceptor-π-donor-π-acceptor-type compounds were synthesized from 4,4′-(hexylimino)bis(benzaldehyde) as a donor and 2-methylthiazolo[4,5-b]quinoxaline derivatives as strong electron acceptors condensed by classical Knoevenagel condensation. Their absorption, emission, and thermal properties and electrochemical stability were investigated. It was found that the strong electron acceptor-donor chromophoric system of these compounds showed high Stokes shift, excellent thermal stability, and electrochemical reversibility. The solvatochromic behavior of these colorants was studied by using various solvents such as toluene, chloroform, ethyl acetate, tetrahydrofuran, methanol, and N,N-dimethylformamide in increasing order of polarity. The dyes were characterized by means of elemental analysis, 1H NMR, and mass spectrometry. Springer-Verlag 2010.
