25631-05-4 Usage
Uses
Used in Pharmaceutical Industry:
4-Fluoro-DL-tryptophan serves as a precursor for the synthesis of various tryptophan analogs and related compounds, which have potential therapeutic applications. Its unique structure allows for the development of new drugs and treatments for a range of medical conditions.
Used in Research:
In the research field, 4-fluoro-DL-tryptophan is utilized for studies related to the structure and function of tryptophan-containing proteins and enzymes. Its presence can provide insights into the mechanisms of action and potential modifications that can enhance or alter the activity of these biological molecules.
Used in Drug Development:
4-Fluoro-DL-tryptophan may have potential application in the development of new drugs, particularly in the areas of medicinal chemistry and pharmacology. Its incorporation into drug molecules can lead to the discovery of novel therapeutic agents with improved efficacy and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 25631-05-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,6,3 and 1 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 25631-05:
(7*2)+(6*5)+(5*6)+(4*3)+(3*1)+(2*0)+(1*5)=94
94 % 10 = 4
So 25631-05-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H11FN2O2/c12-7-2-1-3-9-10(7)6(5-14-9)4-8(13)11(15)16/h1-3,5,8,14H,4,13H2,(H,15,16)/t8-/m0/s1
