25680-54-0 Usage
Uses
Used in Chemical Reactions:
3-ethyl-(1H)-pyrazin-2-one is used as a reactant in various chemical reactions for the synthesis of different compounds. Its presence in these reactions can lead to the formation of new molecules with potential applications in various industries.
Used in Laboratory Research:
3-ethyl-(1H)-pyrazin-2-one is used as a research compound in laboratories, where it can be studied for its chemical properties, reactivity, and potential interactions with other compounds. This research can contribute to the development of new chemical processes and the discovery of new applications for 3-ethyl-(1H)-pyrazin-2-one.
Used in Industrial Processes:
3-ethyl-(1H)-pyrazin-2-one is used as an intermediate in industrial processes, where it can be a part of the production of various chemical products. Its role in these processes can be crucial for the synthesis of final products with specific properties and applications.
Used in Pharmaceutical Development:
3-ethyl-(1H)-pyrazin-2-one is used as a potential candidate in pharmaceutical development, where it can be studied for its potential therapeutic effects and interactions with biological systems. Its properties may contribute to the development of new drugs or drug delivery systems.
Used in Material Science:
3-ethyl-(1H)-pyrazin-2-one is used in material science research, where it can be investigated for its potential use in the development of new materials with specific properties, such as improved stability, reactivity, or other characteristics that can be beneficial in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 25680-54-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,6,8 and 0 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 25680-54:
(7*2)+(6*5)+(5*6)+(4*8)+(3*0)+(2*5)+(1*4)=120
120 % 10 = 0
So 25680-54-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c1-2-5-6(9)8-4-3-7-5/h3-4H,2H2,1H3,(H,8,9)
25680-54-0Relevant academic research and scientific papers
N-heterocyclyl sulphonamide derivatives and their use as endothelin antagonists
-
, (2008/06/13)
The invention concerns pharmaceutically useful N-heterocyclyl sulphonamide derivatives, their pharmaceutically acceptable salts, processes for their manufacture, their use for antagonising one or more actions of endothelin in a human or other warm-blooded animal, their use in methods of treatment of diseases or medical conditions in which elevated or abnormal levels of endothelin play a significant causative role.
