TERIZIDONE is a chemical with a specific purpose. Lookchem provides you with multiple data and supplier information of this chemical.

25683-71-0

Post Buying Request

Basic information
1. Product Name: TERIZIDONE
2. Synonyms: TERIZIDONE;4,4'-(p-Phenylenebis(methyleneamino))di-(isoxazolidin-3-one);4,4'-[1,4-Phenylenebis(methylidynenitrilo)]bis(isoxazolidin-3-one);Einecs 247-186-1;Terizidona;Terizidona [inn-spanish];Terizidonum;Terizidonum [inn-latin]
3. CAS NO:25683-71-0
4. Molecular Formula: C₁₄H₁₄N₄O₄
5. Molecular Weight: 302.29
6. EINECS: 247-186-1
7. Product Categories: Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals
8. Mol File: 25683-71-0.mol
Chemical Properties
1. Melting Point: 204-205℃
2. Boiling Point: N/A
3. Flash Point: N/A
4. Appearance: /
5. Density: 1.52
6. Refractive Index: 1.691
7. Storage Temp.: Refrigerator, Under Inert Atmosphere
8. Solubility: DMSO (Slightly, Heated), Methanol (Slightly, Heated)
9. PKA: 14.08±0.40(Predicted)
10. CAS DataBase Reference: TERIZIDONE(CAS DataBase Reference)
11. NIST Chemistry Reference: TERIZIDONE(25683-71-0)
12. EPA Substance Registry System: TERIZIDONE(25683-71-0)
Safety Data
1. Hazard Codes: N/A
2. Statements: N/A
3. Safety Statements: N/A
4. WGK Germany:
5. RTECS:
6. HazardClass: N/A
7. PackingGroup: N/A
8. Hazardous Substances Data: 25683-71-0(Hazardous Substances Data)

Suppliers
Usage
Synthetic route
Upstream product
Downstream Products

25683-71-0 Suppliers

Recommended suppliers

25683-71-0 Usage

Uses

Different sources of media describe the Uses of 25683-71-0 differently. You can refer to the following data:
1. TERIZIDONE is a drug used to treat tuberculosis.
2. A drug used to treat tuberculosis.

Check Digit Verification of cas no

The CAS Registry Mumber 25683-71-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,6,8 and 3 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25683-71:
(7*2)+(6*5)+(5*6)+(4*8)+(3*3)+(2*7)+(1*1)=130
130 % 10 = 0
So 25683-71-0 is a valid CAS Registry Number.

InChI:InChI=1/C14H14N4O4/c19-13-11(7-21-17-13)15-5-9-1-2-10(4-3-9)6-16-12-8-22-18-14(12)20/h1-6,11-12H,7-8H2,(H,17,19)(H,18,20)/b15-5+,16-6+