25706-29-0 Usage
Uses
Used in Organic Synthesis:
2-(METHYLTHIO)-1,3-BENZOTHIAZOL-6-AMINE is used as a key intermediate in the synthesis of various organic compounds. Its presence in the molecular structure allows for the formation of a wide range of chemical entities, contributing to the development of new materials and chemical products.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 2-(METHYLTHIO)-1,3-BENZOTHIAZOL-6-AMINE is utilized as a building block for the development of potential drug candidates. Its unique chemical properties and structural features make it a promising candidate for the design of new therapeutic agents.
Used in Medicinal Chemistry:
2-(METHYLTHIO)-1,3-BENZOTHIAZOL-6-AMINE is employed in medicinal chemistry for the exploration of its potential biological activities. Ongoing research aims to uncover its therapeutic potential, which may lead to the discovery of new treatments for various diseases and conditions.
Each of these applications underscores the versatility and importance of 2-(METHYLTHIO)-1,3-BENZOTHIAZOL-6-AMINE in the realms of chemical and pharmaceutical sciences, highlighting its role in the advancement of new technologies and therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 25706-29-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,7,0 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 25706-29:
(7*2)+(6*5)+(5*7)+(4*0)+(3*6)+(2*2)+(1*9)=110
110 % 10 = 0
So 25706-29-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H8N2S2/c1-11-8-10-6-3-2-5(9)4-7(6)12-8/h2-4H,9H2,1H3
