25709-16-4 Usage
Benzamide derivative
A chemical structure based on a benzene ring with a carbonyl group (C=O) attached to an amide group (CONH2).
Allyloxy group
A chemical group with the structure CH2=CHCH2Othat is attached to the benzene ring in the compound.
Piperidinoethyl group
A chemical group with the structure C5H10Nthat is attached to the benzene ring in the compound.
Chlorine atom at the 4th position
A chlorine atom (Cl) attached to the 4th carbon atom of the benzene ring in the compound.
Organic synthesis
The process of designing and constructing organic molecules with specific properties and functions.
Pharmaceutical research
The study of the compound's potential use in the development of new drugs.
Building block
A simple molecule that can be used to create more complex molecules in organic synthesis.
Reagent
A chemical substance used in chemical reactions to produce or modify other substances.
Medicinal chemistry
The field of chemistry focused on designing, synthesizing, and evaluating compounds with potential therapeutic applications.
Pharmaceutical sciences
The interdisciplinary field focused on the development, formulation, and evaluation of drugs for medical use.
Check Digit Verification of cas no
The CAS Registry Mumber 25709-16-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,7,0 and 9 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 25709-16:
(7*2)+(6*5)+(5*7)+(4*0)+(3*9)+(2*1)+(1*6)=114
114 % 10 = 4
So 25709-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C17H23ClN2O2/c1-2-12-22-16-13-14(18)6-7-15(16)17(21)19-8-11-20-9-4-3-5-10-20/h2,6-7,13H,1,3-5,8-12H2,(H,19,21)
