25747-74-4 Usage
Main properties
1. High impact resistance
2. Heat resistance
3. Chemical resistance
4. Ease of processing
5. Easily colored and molded
Specific content
1. Material: 2-Propenenitrile, polymer with (1-methylethenyl)benzene
2. Components: 2-propenenitrile (acrylonitrile) and (1-methylethenyl)benzene (styrene)
3. Common name: Acrylonitrile butadiene styrene (ABS)
4. Uses: Production of consumer and industrial products such as piping, automotive parts, and electronic housings
5. Versatility: Can be easily colored and molded into various shapes and sizes.
Check Digit Verification of cas no
The CAS Registry Mumber 25747-74-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,7,4 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 25747-74:
(7*2)+(6*5)+(5*7)+(4*4)+(3*7)+(2*7)+(1*4)=134
134 % 10 = 4
So 25747-74-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H10.C3H3N/c1-8(2)9-6-4-3-5-7-9;1-2-3-4/h3-7H,1H2,2H3;2H,1H2
