25764-78-7 Usage
General Description
CHEMBRDG-BB 7257964 is a chemical compound with the molecular formula C23H26FNO2S. It is classified as a benzamide derivative and is commonly used in medicinal chemistry research. CHEMBRDG-BB 7257964 is known to have potential therapeutic properties, particularly in the treatment of cancer and inflammatory diseases. Its precise mechanism of action and specific biological targets are not well-documented, but it is thought to interact with cellular signaling pathways related to cell growth and inflammation. Further research is needed to fully understand the potential uses and effects of CHEMBRDG-BB 7257964.
Check Digit Verification of cas no
The CAS Registry Mumber 25764-78-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,7,6 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 25764-78:
(7*2)+(6*5)+(5*7)+(4*6)+(3*4)+(2*7)+(1*8)=137
137 % 10 = 7
So 25764-78-7 is a valid CAS Registry Number.
InChI:InChI=1/C9H9ClN2O/c10-8-7(2-1-5-11-8)9(13)12-6-3-4-6/h1-2,5-6H,3-4H2,(H,12,13)
