2578-27-0 Usage
Description
SELENO-D,L-ETHIONINE is a chemical compound with the chemical properties of off-white crystals. It is known for its role as a substrate for methionine adenosyltransferase, an enzyme found in rat liver.
Uses
Used in Biochemical Research:
SELENO-D,L-ETHIONINE is used as a substrate for methionine adenosyltransferase from rat liver, which is crucial in biochemical research for understanding the enzyme's function and its role in various biological processes.
Used in Pharmaceutical Industry:
SELENO-D,L-ETHIONINE is used as a pharmaceutical intermediate for the synthesis of various drugs, particularly those targeting the methionine adenosyltransferase enzyme, which is involved in the regulation of cellular processes and has potential therapeutic applications.
Used in Chemical Synthesis:
SELENO-D,L-ETHIONINE is used as a chemical intermediate in the synthesis of other compounds, taking advantage of its unique properties as off-white crystals to facilitate specific chemical reactions and product formation.
Check Digit Verification of cas no
The CAS Registry Mumber 2578-27-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,5,7 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 2578-27:
(6*2)+(5*5)+(4*7)+(3*8)+(2*2)+(1*7)=100
100 % 10 = 0
So 2578-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO2Se/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)