2578-75-8 Usage
Uses
Used in Pharmaceutical Industry:
1,3,4-Thiadiazole, 2-acetamido-5-(5-nitro-2-furyl)is used as a pharmaceutical agent for its potential anti-inflammatory and anti-cancer properties. 1,3,4-Thiadiazole, 2-acetamido-5(5-nitro-2-furyl)-'s unique structure allows for the modulation of various biological pathways and targets, making it a valuable candidate for the treatment of inflammatory conditions and cancer.
1. As an Anti-inflammatory Agent:
1,3,4-Thiadiazole, 2-acetamido-5-(5-nitro-2-furyl)is used as an anti-inflammatory agent to alleviate symptoms associated with inflammation. Its pharmacological properties enable it to modulate inflammatory mediators and signaling pathways, reducing inflammation and associated discomfort.
2. As an Anti-cancer Agent:
1,3,4-Thiadiazole, 2-acetamido-5-(5-nitro-2-furyl)is used as an anti-cancer agent, targeting various types of cancer cells. Its ability to interfere with cellular processes and signaling pathways involved in cancer progression makes it a potential therapeutic option for cancer treatment. 1,3,4-Thiadiazole, 2-acetamido-5(5-nitro-2-furyl)has shown promise in inhibiting tumor growth and inducing cell death in various cancer models.
3. In Drug Design and Development:
1,3,4-Thiadiazole, 2-acetamido-5-(5-nitro-2-furyl)serves as a valuable scaffold in drug design and development. Its unique structure and pharmacological properties make it an attractive starting point for the synthesis of novel drugs with improved efficacy and selectivity. Researchers can modify its functional groups to optimize its therapeutic potential and minimize side effects.
4. In Medicinal Chemistry Research:
1,3,4-Thiadiazole, 2-acetamido-5-(5-nitro-2-furyl)is used in medicinal chemistry research to explore its structure-activity relationship and optimize its pharmacological properties. By studying the compound's interactions with biological targets and understanding its mechanism of action, researchers can design more effective and safer drugs based on its structure.
Check Digit Verification of cas no
The CAS Registry Mumber 2578-75-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,5,7 and 8 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 2578-75:
(6*2)+(5*5)+(4*7)+(3*8)+(2*7)+(1*5)=108
108 % 10 = 8
So 2578-75-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H6N4O4S/c1-4(13)9-8-11-10-7(17-8)5-2-3-6(16-5)12(14)15/h2-3H,1H3,(H,9,11,13)
