257932-29-9 Usage
General Description
2-HYDROXYBICYCLO[3.2.1]OCTANE-6-CARBOXYLIC ACID is a chemical compound with the molecular formula C9H14O3. It is a bicyclic compound with a six-membered ring and a carboxylic acid functional group. 2-HYDROXYBICYCLO[3.2.1]OCTANE-6-CARBOXYLIC ACID has a hydroxyl group attached to a bicyclic carbon and a carboxylic acid group attached to another carbon, resulting in a complex structure. It is used in pharmaceutical research and development as a building block for the synthesis of various drug candidates and potential biologically active compounds. 2-HYDROXYBICYCLO[3.2.1]OCTANE-6-CARBOXYLIC ACID has potential applications in medicinal chemistry and drug design due to its unique structure and functional groups.
Check Digit Verification of cas no
The CAS Registry Mumber 257932-29-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,7,9,3 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 257932-29:
(8*2)+(7*5)+(6*7)+(5*9)+(4*3)+(3*2)+(2*2)+(1*9)=169
169 % 10 = 9
So 257932-29-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H14O3/c10-8-2-1-5-3-6(8)4-7(5)9(11)12/h5-8,10H,1-4H2,(H,11,12)