2582-42-5 Usage
Uses
Used in Dye and Pigment Production:
2,6-Dichloro-4-[(3-chloro-4-hydroxyphenyl)imino]-2,5-cyclohexadien-1-one is used as a key intermediate in the production of dyes and pigments. Its unique chemical structure contributes to the color and stability of these products, making it an essential component in this industry.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2,6-Dichloro-4-[(3-chloro-4-hydroxyphenyl)imino]-2,5-cyclohexadien-1-one serves as a crucial intermediate for the synthesis of various drugs. Its chemical properties allow for the development of new pharmaceutical compounds with potential therapeutic benefits.
Used in Agricultural Chemical Synthesis:
2,6-Dichloro-4-[(3-chloro-4-hydroxyphenyl)imino]-2,5-cyclohexadien-1-one is also utilized in the synthesis of agricultural chemicals, where it plays a vital role in the development of new pesticides and other agrochemicals. Its unique properties contribute to the effectiveness and stability of these products.
Used as an Antioxidant and Radical Scavenger in Medicinal Chemistry:
2,6-Dichloro-4-[(3-chloro-4-hydroxyphenyl)imino]-2,5-cyclohexadien-1-one is recognized for its potential as an antioxidant and radical scavenger. In the field of medicinal chemistry, it is used to develop compounds that can protect against oxidative stress and prevent damage caused by free radicals.
Used in Chemical and Industrial Processes as a Reagent and Intermediate:
Due to its unique chemical properties, 2,6-Dichloro-4-[(3-chloro-4-hydroxyphenyl)imino]-2,5-cyclohexadien-1-one is employed as a reagent and intermediate in various chemical and industrial processes. Its versatility allows it to be used in a wide range of applications, contributing to the development of new products and processes across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 2582-42-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,5,8 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 2582-42:
(6*2)+(5*5)+(4*8)+(3*2)+(2*4)+(1*2)=85
85 % 10 = 5
So 2582-42-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H6Cl3NO2/c13-8-3-6(1-2-11(8)17)16-7-4-9(14)12(18)10(15)5-7/h1-5,18H/b16-6+
