258273-32-4 Usage
Uses
Used in Pharmaceutical Industry:
3-CYANO-4-ETHOXYBENZOIC ACID is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs. Its unique structure allows it to be a key component in creating various medicinal compounds.
Used in Agrochemical Industry:
In the agrochemical sector, 3-CYANO-4-ETHOXYBENZOIC ACID is utilized as an intermediate in the production of agrochemicals, playing a role in the development of pesticides and other agricultural chemicals that are essential for crop protection and yield enhancement.
Used in Dye and Pigment Production:
3-CYANO-4-ETHOXYBENZOIC ACID is used as a raw material in the production of dyes and pigments, contributing to the coloration and stability of these products. Its chemical properties make it suitable for creating a wide range of colors used in various applications.
Used in Polymer Manufacturing:
3-CYANO-4-ETHOXYBENZOIC ACID is also used in the manufacture of polymers, where it can influence the polymer's properties, such as strength, flexibility, and durability. Its inclusion in polymer production can lead to the development of new materials with specific characteristics for various applications.
Used in Medicinal and Biochemical Research:
3-CYANO-4-ETHOXYBENZOIC ACID exhibits potential biological activity, making it of interest in medicinal and biochemical research. Researchers explore its properties to understand its possible role in the development of new therapies and biochemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 258273-32-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,8,2,7 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 258273-32:
(8*2)+(7*5)+(6*8)+(5*2)+(4*7)+(3*3)+(2*3)+(1*2)=154
154 % 10 = 4
So 258273-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO3/c1-2-14-9-4-3-7(10(12)13)5-8(9)6-11/h3-5H,2H2,1H3,(H,12,13)
