258530-60-8 Usage
Uses
Used in Organic Synthesis:
1-Oxide-4-thiomorpholine acetic acid is used as a versatile building block in organic synthesis for the creation of a wide range of bioactive molecules. Its unique structure allows for the development of new compounds with potential applications across various fields.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 1-Oxide-4-thiomorpholine acetic acid is used as a key component in the research and development of potential therapeutic agents. Its ability to modulate biological processes and its potential pharmacological activity make it a promising candidate for the creation of new medicines.
Used in Medicinal Chemistry:
1-Oxide-4-thiomorpholine acetic acid is utilized in medicinal chemistry for its potential to contribute to the discovery of new drugs. Its structural features and chemical properties are harnessed to design and synthesize compounds with specific biological activities, targeting various diseases and conditions.
Used in Drug Discovery:
In the field of drug discovery, 1-Oxide-4-thiomorpholine acetic acid plays a crucial role as a starting material or intermediate in the synthesis of novel drug candidates. Its unique chemical properties and potential to interact with biological targets make it an important asset in the development of innovative therapeutics.
Check Digit Verification of cas no
The CAS Registry Mumber 258530-60-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,8,5,3 and 0 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 258530-60:
(8*2)+(7*5)+(6*8)+(5*5)+(4*3)+(3*0)+(2*6)+(1*0)=148
148 % 10 = 8
So 258530-60-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H11NO3S/c8-6(9)5-7-1-3-11(10)4-2-7/h1-5H2,(H,8,9)
