25855-27-0 Usage
Uses
Used in Pharmaceutical Industry:
1-ALLYL-2,4-DIOXO-1,2,3,4-TETRAHYDRO-5-PYRIMIDINECARBONITRILE is used as a reactant in the preparation of N-?sulfanilyl-?l-?alkylcytosines, which are short-acting sulfanilamides. These sulfanilamides are important in the development of antimicrobial and antifungal drugs, as they exhibit potent activity against a wide range of pathogens.
In the synthesis of N-?sulfanilyl-?l-?alkylcytosines, 1-ALLYL-2,4-DIOXO-1,2,3,4-TETRAHYDRO-5-PYRIMIDINECARBONITRILE serves as a key intermediate, providing the necessary structural elements for the formation of the final product. The allyl group in the compound can be further modified or functionalized to introduce various substituents, enhancing the biological activity and selectivity of the resulting sulfanilamides.
Additionally, the carbonitrile group in the molecule can be converted into other functional groups, such as amines or amides, through chemical reactions. This allows for the creation of a diverse range of sulfanilamides with different properties and applications in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 25855-27-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,8,5 and 5 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 25855-27:
(7*2)+(6*5)+(5*8)+(4*5)+(3*5)+(2*2)+(1*7)=130
130 % 10 = 0
So 25855-27-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O2/c1-2-3-11-5-6(4-9)7(12)10-8(11)13/h2,5H,1,3H2,(H,10,12,13)
