25953-14-4 Usage
Uses
Used in Biochemistry and Molecular Biology Research:
5'-Iodo-5'-deoxythymidine is used as a DNA precursor for studying the mechanisms of DNA replication and the effects of nucleoside analogs on cellular processes. Its incorporation into DNA can provide insights into the regulation of DNA synthesis and the consequences of altered DNA structure on cell function.
Used in Antiviral Applications:
In the medical field, 5'-iodo-5'-deoxythymidine is being investigated for its potential antiviral properties, particularly in the treatment of herpes virus infections. Its ability to interfere with DNA synthesis may inhibit viral replication, offering a therapeutic approach to managing viral diseases.
Used in Cancer Therapy Research:
5'-Iodo-5'-deoxythymidine is also being studied for its potential use in cancer therapies. 5'-IODO-5'-DEOXYTHYMIDINE may inhibit the growth of cancer cells by disrupting their ability to replicate DNA, which could lead to the development of novel treatments for various types of cancer.
Used in Pharmaceutical Development:
5'-IODO-5'-DEOXYTHYMIDINE's ability to interfere with DNA synthesis makes it a candidate for the development of pharmaceuticals targeting diseases that involve abnormal cell proliferation, such as cancer and viral infections. Further research is needed to optimize its therapeutic potential and minimize potential side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 25953-14-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,9,5 and 3 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 25953-14:
(7*2)+(6*5)+(5*9)+(4*5)+(3*3)+(2*1)+(1*4)=124
124 % 10 = 4
So 25953-14-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H13IN2O4/c1-5-4-13(10(16)12-9(5)15)8-2-6(14)7(3-11)17-8/h4,6-8,14H,2-3H2,1H3,(H,12,15,16)
