25957-71-5 Usage
General Description
(1H-Pyrrolo[2,3-c]pyridin-3-yl)MethanaMine, also known as PMM, is a chemical compound with the molecular formula C8H7N3. It is a heterocyclic amine with a pyrrolopyridine structure, and it is used in the pharmaceutical and chemical industries as a building block for the synthesis of various bioactive molecules. PMM has been studied for its potential as a pharmaceutical intermediate and it exhibits antibacterial and antifungal properties, making it a promising candidate for the development of new drugs. Additionally, it has been investigated for its potential use in organic synthesis and as a reagent in chemical reactions. Overall, (1H-Pyrrolo[2,3-c]pyridin-3-yl)MethanaMine is a versatile compound with diverse potential applications in the field of chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 25957-71-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,9,5 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25957-71:
(7*2)+(6*5)+(5*9)+(4*5)+(3*7)+(2*7)+(1*1)=145
145 % 10 = 5
So 25957-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3/c9-3-6-4-11-8-5-10-2-1-7(6)8/h1-2,4-5,11H,3,9H2
