25957-71-5 Usage
Uses
Used in Pharmaceutical Industry:
(1H-Pyrrolo[2,3-c]pyridin-3-yl)MethanaMine is used as a pharmaceutical intermediate for the development of new drugs. It exhibits antibacterial and antifungal properties, making it a promising candidate for the synthesis of bioactive molecules with potential therapeutic applications.
Used in Chemical Industry:
(1H-Pyrrolo[2,3-c]pyridin-3-yl)MethanaMine is used as a building block in the synthesis of various chemical compounds. Its versatile structure allows for its use in organic synthesis and as a reagent in chemical reactions, contributing to the development of new chemical products and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 25957-71-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,9,5 and 7 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 25957-71:
(7*2)+(6*5)+(5*9)+(4*5)+(3*7)+(2*7)+(1*1)=145
145 % 10 = 5
So 25957-71-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H9N3/c9-3-6-4-11-8-5-10-2-1-7(6)8/h1-2,4-5,11H,3,9H2
