2598-76-7 Usage
Chemical class
Hydrazine
Functionality
Monoamine oxidase inhibitor
Psychoactive drug
Yes
Medical use
Treating depression and anxiety
Mechanism of action
Inhibits the enzyme monoamine oxidase, leading to increased levels of neurotransmitters such as serotonin and dopamine in the brain
Decline in use
Due to availability of more effective and safer antidepressant medications
Potential side effects
Hypertensive crisis and serotonin syndrome
Current relevance
Important compound for research into the development of new antidepressant drugs
Check Digit Verification of cas no
The CAS Registry Mumber 2598-76-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 2,5,9 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 2598-76:
(6*2)+(5*5)+(4*9)+(3*8)+(2*7)+(1*6)=117
117 % 10 = 7
So 2598-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C17H22N2/c1-15(14-17-10-6-3-7-11-17)19-18-13-12-16-8-4-2-5-9-16/h2-11,15,18-19H,12-14H2,1H3
