259807-47-1 Usage
Uses
Used in Pharmaceutical Industry:
5-Pyrimidinecarboxylic acid, 2-(4-pyridinyl)(9CI) is used as a building block for the synthesis of pharmaceutical compounds. Its unique structure and properties make it a valuable component in the development of new drugs and therapeutic agents.
Used in Organic Synthesis:
As a member of the pyrimidinecarboxylic acid family, 5-Pyrimidinecarboxylic acid, 2-(4-pyridinyl)(9CI) is used as a key intermediate in various organic reactions. Its presence of pyridine and carboxylic acid functional groups allows for versatile chemical transformations, contributing to the synthesis of a wide range of organic compounds.
While the specific applications of 5-Pyrimidinecarboxylic acid, 2-(4-pyridinyl)(9CI) in different industries may require further exploration, its role in the pharmaceutical industry and organic synthesis is well-established. Its potential for use in drug development and as a versatile building block in organic chemistry highlights the importance of continued research and study to fully understand and harness its capabilities.
Check Digit Verification of cas no
The CAS Registry Mumber 259807-47-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,5,9,8,0 and 7 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 259807-47:
(8*2)+(7*5)+(6*9)+(5*8)+(4*0)+(3*7)+(2*4)+(1*7)=181
181 % 10 = 1
So 259807-47-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H7N3O2/c14-10(15)8-5-12-9(13-6-8)7-1-3-11-4-2-7/h1-6H,(H,14,15)
