26007-43-2 Usage
Uses
Used in Plastics Industry:
Bicyclo2.2.1hept-2-ene, polymer with ethene is used as a plastic material for its unique properties, such as strength, flexibility, and chemical resistance. The polymer's structure allows for the creation of durable and versatile plastic products that can be tailored to specific applications.
Used in Coatings Industry:
In the coatings industry, Bicyclo2.2.1hept-2-ene, polymer with ethene is used as a coating material to provide a protective layer on various surfaces. The polymer's properties, such as adhesion, durability, and resistance to environmental factors, make it an ideal choice for coatings that require long-lasting protection.
Used in Adhesives Industry:
Bicyclo2.2.1hept-2-ene, polymer with ethene is used as an adhesive material due to its strong bonding capabilities and compatibility with various substrates. The polymer's unique properties allow it to form strong bonds with different materials, making it suitable for use in adhesive formulations.
Used in Other Material Industries:
Bicyclo2.2.1hept-2-ene, polymer with ethene can also be used in other material industries where its unique properties can be leveraged to create innovative products. The polymer's versatility and adaptability make it a valuable component in the development of new materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 26007-43-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,0,0 and 7 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 26007-43:
(7*2)+(6*6)+(5*0)+(4*0)+(3*7)+(2*4)+(1*3)=82
82 % 10 = 2
So 26007-43-2 is a valid CAS Registry Number.
InChI:InChI=1/C7H10.C2H4/c1-2-7-4-3-6(1)5-7;1-2/h1-2,6-7H,3-5H2;1-2H2
