26028-64-8 Usage
Description
5-(3-CHLOROPHENYL)-4-ISOBUTYL-4H-1,2,4-TRIAZOLE-3-THIOL is a triazole-thiol derivative with the molecular formula C13H15ClN4S. It is a compound that belongs to the class of organic compounds known for their applications in pharmaceuticals, agriculture, and materials science. This specific compound features a triazole ring, a thiol group, and a chlorophenyl substituent, which endows it with unique chemical properties and a range of potential applications. Its study has shown promise in areas such as antimicrobial, antifungal, and anticancer properties, and it serves as a building block for the synthesis of other bioactive molecules.
Uses
Used in Pharmaceutical Industry:
5-(3-CHLOROPHENYL)-4-ISOBUTYL-4H-1,2,4-TRIAZOLE-3-THIOL is used as a pharmaceutical compound for its potential antimicrobial, antifungal, and anticancer properties. Its unique structure allows it to target specific biological pathways, making it a candidate for the development of new drugs to combat various diseases.
Used in Agricultural Industry:
In agriculture, 5-(3-CHLOROPHENYL)-4-ISOBUTYL-4H-1,2,4-TRIAZOLE-3-THIOL is used as a bioactive molecule to protect crops from microbial and fungal infections. Its ability to inhibit the growth of harmful organisms contributes to maintaining crop health and increasing yield.
Used in Materials Science:
5-(3-CHLOROPHENYL)-4-ISOBUTYL-4H-1,2,4-TRIAZOLE-3-THIOL is utilized as a building block in materials science for the synthesis of new materials with specific properties. Its chemical structure can be incorporated into the design of advanced materials for various applications, such as sensors, catalysts, or drug delivery systems.
Used in Research and Development:
5-(3-CHLOROPHENYL)-4-ISOBUTYL-4H-1,2,4-TRIAZOLE-3-THIOL serves as a subject of research for further exploration of its chemical properties and potential uses. Scientists and researchers investigate its interactions with biological systems and its capacity for synthesis into new bioactive molecules, which could lead to breakthroughs in medicine and other fields.
Check Digit Verification of cas no
The CAS Registry Mumber 26028-64-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,0,2 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 26028-64:
(7*2)+(6*6)+(5*0)+(4*2)+(3*8)+(2*6)+(1*4)=98
98 % 10 = 8
So 26028-64-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H14ClN3S/c1-8(2)7-16-11(14-15-12(16)17)9-4-3-5-10(13)6-9/h3-6,8H,7H2,1-2H3,(H,15,17)