26049-68-3 Usage
General Description
[4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine is a chemical compound with a molecular formula C6H5N5OS. It is a yellow crystalline solid that is used in scientific research as a chemical intermediate and in pharmaceutical development. [4-(5-nitro-2-furyl)-1,3-thiazol-2-yl]hydrazine has shown potential as an antimicrobial agent and has been studied for its potential use in the treatment of various diseases. Additionally, it has been investigated for its possible use as a pesticide and as a precursor in the synthesis of other organic compounds. The nitro and thiazole groups within the molecule give it specific chemical properties that make it useful for various applications in the field of chemistry and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 26049-68-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,0,4 and 9 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 26049-68:
(7*2)+(6*6)+(5*0)+(4*4)+(3*9)+(2*6)+(1*8)=113
113 % 10 = 3
So 26049-68-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4O3S/c8-10-7-9-4(3-15-7)5-1-2-6(14-5)11(12)13/h1-3H,8H2,(H,9,10)